CasNo: 57-11-4
Molecular Formula: C18H36O2
Appearance: White solid with a mild odor
Who Evaluation |
Evaluation year: 1997 |
Description | Stearic acid, also known as octadecanoic acid, is a saturated fatty acid with a waxy appearance. It is a long-chain fatty acid with an 18-carbon backbone, making it a saturated fatty acid. |
Uses | Stearic acid is considered a healthy form of saturated fat and is believed not to significantly raise the risk of heart disease. It differs from certain other saturated fats that are known to be less heart-healthy. The health effects of dietary fats can vary based on their specific chemical structure. |
InChI:InChI=1/C18H36O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h2-17H2,1H3,(H,19,20)
The chemistry of five African Croton tax...
A new stearoyl glucoside of ursolic acid...
Lipids are a promising feedstock to prod...
The GC properties of 18:5n3 (all-cis-3,6...
Herein, catalytic application of a metal...
Hydrolysis of amides to carboxylic acids...
Hericium erinaceus is a very popular edi...
N-benzyl-octadecanamide
stearic acid
benzylamine
Conditions | Yield |
---|---|
mit UV-Licht.Irradiation;
|
linoleic acid
cis-9,trans-11-octadecadienoic acid
trans-9,trans-11-octadecadienoic acid
trans-10,cis-12-octadecadienoic acid
stearic acid
Conditions | Yield |
---|---|
With hydrogen; silver; silica gel; In decane; at 164.85 ℃; for 1.5h;
|
n-hexadecylmalonic acid
ethanol
1,2-di-O-stearoyl-rac-3-glycerophosphate
Petroselinic acid
octadecanoic acid, 1,2-ethanediyl ester
1-[2]thienyl-octadecan-1-one
stearic acid-(1-methyl-3-tetrahydro[2]furyl-propyl ester)
2-heptadecyl-2-imidazoline